C13H14N2O4 — CID 2564011
[2-(2-cyanoanilino)-2-oxoethyl] 2-ethoxyacetate (PubChem CID 2564011) has the molecular formula C13H14N2O4 and a molecular weight of 262.26 g/mol. Its IUPAC name is [2-(2-cyanoanilino)-2-oxoethyl] 2-ethoxyacetate.
| Compound Name | [2-(2-cyanoanilino)-2-oxoethyl] 2-ethoxyacetate |
|---|---|
| PubChem CID | 2564011 |
| Molecular Formula | C13H14N2O4 |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | [2-(2-cyanoanilino)-2-oxoethyl] 2-ethoxyacetate |
| SMILES | CCOCC(=O)OCC(=O)Nc1ccccc1C#N |
| InChI | InChI=1S/C13H14N2O4/c1-2-18-9-13(17)19-8-12(16)15-11-6-4-3-5-10(11)7-14/h3-6H,2,8-9H2,1H3,(H,15,16) |
| InChIKey | GAAIVSAPLSYWRK-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.26 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |