C23H23NO6 — CID 8525388
methyl 3-[[2-[2-(6-ethyl-1-benzofuran-3-yl)acetyl]oxyacetyl]amino]-4-methylbenzoate (PubChem CID 8525388) has the molecular formula C23H23NO6 and a molecular weight of 409.44 g/mol. Its IUPAC name is methyl 3-[[2-[2-(6-ethyl-1-benzofuran-3-yl)acetyl]oxyacetyl]amino]-4-methylbenzoate.
| Compound Name | methyl 3-[[2-[2-(6-ethyl-1-benzofuran-3-yl)acetyl]oxyacetyl]amino]-4-methylbenzoate |
|---|---|
| PubChem CID | 8525388 |
| Molecular Formula | C23H23NO6 |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | methyl 3-[[2-[2-(6-ethyl-1-benzofuran-3-yl)acetyl]oxyacetyl]amino]-4-methylbenzoate |
| SMILES | CCc1ccc2c(CC(=O)OCC(=O)Nc3cc(C(=O)OC)ccc3C)coc2c1 |
| InChI | InChI=1S/C23H23NO6/c1-4-15-6-8-18-17(12-29-20(18)9-15)11-22(26)30-13-21(25)24-19-10-16(23(27)28-3)7-5-14(19)2/h5-10,12H,4,11,13H2,1-3H3,(H,24,25) |
| InChIKey | NJQZMIFDNDWPIN-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 94.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |