C20H23ClN2O3 — CID 119439857
N-[2-(ethylaminomethyl)phenyl]-2-(6-methoxy-1-benzofuran-3-yl)acetamide;hydrochloride (PubChem CID 119439857) has the molecular formula C20H23ClN2O3 and a molecular weight of 374.87 g/mol. Its IUPAC name is N-[2-(ethylaminomethyl)phenyl]-2-(6-methoxy-1-benzofuran-3-yl)acetamide;hydrochloride.
| Compound Name | N-[2-(ethylaminomethyl)phenyl]-2-(6-methoxy-1-benzofuran-3-yl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 119439857 |
| Molecular Formula | C20H23ClN2O3 |
| Molecular Weight | 374.87 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | N-[2-(ethylaminomethyl)phenyl]-2-(6-methoxy-1-benzofuran-3-yl)acetamide;hydrochloride |
| SMILES | CCNCc1ccccc1NC(=O)Cc1coc2cc(OC)ccc12.Cl |
| InChI | InChI=1S/C20H22N2O3.ClH/c1-3-21-12-14-6-4-5-7-18(14)22-20(23)10-15-13-25-19-11-16(24-2)8-9-17(15)19;/h4-9,11,13,21H,3,10,12H2,1-2H3,(H,22,23);1H |
| InChIKey | JXMKXSFMGUAGTF-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 63.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.87 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |