C22H23ClN2O2 — CID 8725094
6-chloro-7-methyl-4-[[4-(2-methylphenyl)piperazin-1-yl]methyl]chromen-2-one (PubChem CID 8725094) has the molecular formula C22H23ClN2O2 and a molecular weight of 382.89 g/mol. Its IUPAC name is 6-chloro-7-methyl-4-[[4-(2-methylphenyl)piperazin-1-yl]methyl]chromen-2-one.
| Compound Name | 6-chloro-7-methyl-4-[[4-(2-methylphenyl)piperazin-1-yl]methyl]chromen-2-one |
|---|---|
| PubChem CID | 8725094 |
| Molecular Formula | C22H23ClN2O2 |
| Molecular Weight | 382.89 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | 6-chloro-7-methyl-4-[[4-(2-methylphenyl)piperazin-1-yl]methyl]chromen-2-one |
| SMILES | Cc1cc2oc(=O)cc(CN3CCN(c4ccccc4C)CC3)c2cc1Cl |
| InChI | InChI=1S/C22H23ClN2O2/c1-15-5-3-4-6-20(15)25-9-7-24(8-10-25)14-17-12-22(26)27-21-11-16(2)19(23)13-18(17)21/h3-6,11-13H,7-10,14H2,1-2H3 |
| InChIKey | RKYWXYNXEOFZIC-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 36.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.89 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|