C21H20Cl2N2O3 — CID 9347319
6-chloro-4-[(5-chloro-2-morpholin-4-ylanilino)methyl]-7-methylchromen-2-one (PubChem CID 9347319) has the molecular formula C21H20Cl2N2O3 and a molecular weight of 419.31 g/mol. Its IUPAC name is 6-chloro-4-[(5-chloro-2-morpholin-4-ylanilino)methyl]-7-methylchromen-2-one.
| Compound Name | 6-chloro-4-[(5-chloro-2-morpholin-4-ylanilino)methyl]-7-methylchromen-2-one |
|---|---|
| PubChem CID | 9347319 |
| Molecular Formula | C21H20Cl2N2O3 |
| Molecular Weight | 419.31 g/mol |
| Exact Mass | 418.09 |
| IUPAC Name | 6-chloro-4-[(5-chloro-2-morpholin-4-ylanilino)methyl]-7-methylchromen-2-one |
| SMILES | Cc1cc2oc(=O)cc(CNc3cc(Cl)ccc3N3CCOCC3)c2cc1Cl |
| InChI | InChI=1S/C21H20Cl2N2O3/c1-13-8-20-16(11-17(13)23)14(9-21(26)28-20)12-24-18-10-15(22)2-3-19(18)25-4-6-27-7-5-25/h2-3,8-11,24H,4-7,12H2,1H3 |
| InChIKey | NKKKQNJDZPZRON-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.31 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|