C23H20N6O2S — CID 16583150
5-[3-[[4-benzyl-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]propyl]-3-pyridin-4-yl-1,2,4-oxadiazole (PubChem CID 16583150) has the molecular formula C23H20N6O2S and a molecular weight of 444.52 g/mol. Its IUPAC name is 5-[3-[[4-benzyl-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]propyl]-3-pyridin-4-yl-1,2,4-oxadiazole.
| Compound Name | 5-[3-[[4-benzyl-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]propyl]-3-pyridin-4-yl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 16583150 |
| Molecular Formula | C23H20N6O2S |
| Molecular Weight | 444.52 g/mol |
| Exact Mass | 444.14 |
| IUPAC Name | 5-[3-[[4-benzyl-5-(furan-2-yl)-1,2,4-triazol-3-yl]sulfanyl]propyl]-3-pyridin-4-yl-1,2,4-oxadiazole |
| SMILES | c1ccc(Cn2c(SCCCc3nc(-c4ccncc4)no3)nnc2-c2ccco2)cc1 |
| InChI | InChI=1S/C23H20N6O2S/c1-2-6-17(7-3-1)16-29-22(19-8-4-14-30-19)26-27-23(29)32-15-5-9-20-25-21(28-31-20)18-10-12-24-13-11-18/h1-4,6-8,10-14H,5,9,15-16H2 |
| InChIKey | COWNKDIFHQGCSV-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 95.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.52 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|