C20H21N3O3S — CID 40571999
tert-butyl 2-[3-(4-methyl-2-pyridinyl)-4-oxoquinazolin-2-yl]sulfanylacetate (PubChem CID 40571999) has the molecular formula C20H21N3O3S and a molecular weight of 383.47 g/mol. Its IUPAC name is tert-butyl 2-[3-(4-methyl-2-pyridinyl)-4-oxoquinazolin-2-yl]sulfanylacetate.
| Compound Name | tert-butyl 2-[3-(4-methyl-2-pyridinyl)-4-oxoquinazolin-2-yl]sulfanylacetate |
|---|---|
| PubChem CID | 40571999 |
| Molecular Formula | C20H21N3O3S |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | tert-butyl 2-[3-(4-methyl-2-pyridinyl)-4-oxoquinazolin-2-yl]sulfanylacetate |
| SMILES | Cc1ccnc(-n2c(SCC(=O)OC(C)(C)C)nc3ccccc3c2=O)c1 |
| InChI | InChI=1S/C20H21N3O3S/c1-13-9-10-21-16(11-13)23-18(25)14-7-5-6-8-15(14)22-19(23)27-12-17(24)26-20(2,3)4/h5-11H,12H2,1-4H3 |
| InChIKey | KOJHUOORHAWWMU-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 74.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |