C22H17FN4O2S — CID 55321725
N-(4-fluorophenyl)-2-[3-(4-methyl-2-pyridinyl)-4-oxoquinazolin-2-yl]sulfanylacetamide (PubChem CID 55321725) has the molecular formula C22H17FN4O2S and a molecular weight of 420.47 g/mol. Its IUPAC name is N-(4-fluorophenyl)-2-[3-(4-methyl-2-pyridinyl)-4-oxoquinazolin-2-yl]sulfanylacetamide.
| Compound Name | N-(4-fluorophenyl)-2-[3-(4-methyl-2-pyridinyl)-4-oxoquinazolin-2-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 55321725 |
| Molecular Formula | C22H17FN4O2S |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.11 |
| IUPAC Name | N-(4-fluorophenyl)-2-[3-(4-methyl-2-pyridinyl)-4-oxoquinazolin-2-yl]sulfanylacetamide |
| SMILES | Cc1ccnc(-n2c(SCC(=O)Nc3ccc(F)cc3)nc3ccccc3c2=O)c1 |
| InChI | InChI=1S/C22H17FN4O2S/c1-14-10-11-24-19(12-14)27-21(29)17-4-2-3-5-18(17)26-22(27)30-13-20(28)25-16-8-6-15(23)7-9-16/h2-12H,13H2,1H3,(H,25,28) |
| InChIKey | UIEUCGDMQUBSFS-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |