C23H26N2O3S — CID 7840085
tert-butyl 2-[4-oxo-3-(2-propan-2-ylphenyl)quinazolin-2-yl]sulfanylacetate (PubChem CID 7840085) has the molecular formula C23H26N2O3S and a molecular weight of 410.54 g/mol. Its IUPAC name is tert-butyl 2-[4-oxo-3-(2-propan-2-ylphenyl)quinazolin-2-yl]sulfanylacetate.
| Compound Name | tert-butyl 2-[4-oxo-3-(2-propan-2-ylphenyl)quinazolin-2-yl]sulfanylacetate |
|---|---|
| PubChem CID | 7840085 |
| Molecular Formula | C23H26N2O3S |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | tert-butyl 2-[4-oxo-3-(2-propan-2-ylphenyl)quinazolin-2-yl]sulfanylacetate |
| SMILES | CC(C)c1ccccc1-n1c(SCC(=O)OC(C)(C)C)nc2ccccc2c1=O |
| InChI | InChI=1S/C23H26N2O3S/c1-15(2)16-10-7-9-13-19(16)25-21(27)17-11-6-8-12-18(17)24-22(25)29-14-20(26)28-23(3,4)5/h6-13,15H,14H2,1-5H3 |
| InChIKey | LWSHWINAIYBTDA-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |