C31H26N2O2S — CID 23960255
2-[2-oxo-2-(4-phenylphenyl)ethyl]sulfanyl-3-(2-propan-2-ylphenyl)quinazolin-4-one (PubChem CID 23960255) has the molecular formula C31H26N2O2S and a molecular weight of 490.63 g/mol. Its IUPAC name is 2-[2-oxo-2-(4-phenylphenyl)ethyl]sulfanyl-3-(2-propan-2-ylphenyl)quinazolin-4-one.
| Compound Name | 2-[2-oxo-2-(4-phenylphenyl)ethyl]sulfanyl-3-(2-propan-2-ylphenyl)quinazolin-4-one |
|---|---|
| PubChem CID | 23960255 |
| Molecular Formula | C31H26N2O2S |
| Molecular Weight | 490.63 g/mol |
| Exact Mass | 490.17 |
| IUPAC Name | 2-[2-oxo-2-(4-phenylphenyl)ethyl]sulfanyl-3-(2-propan-2-ylphenyl)quinazolin-4-one |
| SMILES | CC(C)c1ccccc1-n1c(SCC(=O)c2ccc(-c3ccccc3)cc2)nc2ccccc2c1=O |
| InChI | InChI=1S/C31H26N2O2S/c1-21(2)25-12-7-9-15-28(25)33-30(35)26-13-6-8-14-27(26)32-31(33)36-20-29(34)24-18-16-23(17-19-24)22-10-4-3-5-11-22/h3-19,21H,20H2,1-2H3 |
| InChIKey | JSVQCEPZNGRKJQ-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.63 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |