C31H32N2O2S — CID 4534910
2-[2-(4-cyclohexylphenyl)-2-oxoethyl]sulfanyl-3-(2-propan-2-ylphenyl)quinazolin-4-one (PubChem CID 4534910) has the molecular formula C31H32N2O2S and a molecular weight of 496.68 g/mol. Its IUPAC name is 2-[2-(4-cyclohexylphenyl)-2-oxoethyl]sulfanyl-3-(2-propan-2-ylphenyl)quinazolin-4-one.
| Compound Name | 2-[2-(4-cyclohexylphenyl)-2-oxoethyl]sulfanyl-3-(2-propan-2-ylphenyl)quinazolin-4-one |
|---|---|
| PubChem CID | 4534910 |
| Molecular Formula | C31H32N2O2S |
| Molecular Weight | 496.68 g/mol |
| Exact Mass | 496.22 |
| IUPAC Name | 2-[2-(4-cyclohexylphenyl)-2-oxoethyl]sulfanyl-3-(2-propan-2-ylphenyl)quinazolin-4-one |
| SMILES | CC(C)c1ccccc1-n1c(SCC(=O)c2ccc(C3CCCCC3)cc2)nc2ccccc2c1=O |
| InChI | InChI=1S/C31H32N2O2S/c1-21(2)25-12-7-9-15-28(25)33-30(35)26-13-6-8-14-27(26)32-31(33)36-20-29(34)24-18-16-23(17-19-24)22-10-4-3-5-11-22/h6-9,12-19,21-22H,3-5,10-11,20H2,1-2H3 |
| InChIKey | YACVMINAOLPEBQ-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.68 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |