C29H27FN2O2S — CID 4037222
2-[2-(4-cyclohexylphenyl)-2-oxoethyl]sulfanyl-3-[(4-fluorophenyl)methyl]quinazolin-4-one (PubChem CID 4037222) has the molecular formula C29H27FN2O2S and a molecular weight of 486.61 g/mol. Its IUPAC name is 2-[2-(4-cyclohexylphenyl)-2-oxoethyl]sulfanyl-3-[(4-fluorophenyl)methyl]quinazolin-4-one.
| Compound Name | 2-[2-(4-cyclohexylphenyl)-2-oxoethyl]sulfanyl-3-[(4-fluorophenyl)methyl]quinazolin-4-one |
|---|---|
| PubChem CID | 4037222 |
| Molecular Formula | C29H27FN2O2S |
| Molecular Weight | 486.61 g/mol |
| Exact Mass | 486.18 |
| IUPAC Name | 2-[2-(4-cyclohexylphenyl)-2-oxoethyl]sulfanyl-3-[(4-fluorophenyl)methyl]quinazolin-4-one |
| SMILES | O=C(CSc1nc2ccccc2c(=O)n1Cc1ccc(F)cc1)c1ccc(C2CCCCC2)cc1 |
| InChI | InChI=1S/C29H27FN2O2S/c30-24-16-10-20(11-17-24)18-32-28(34)25-8-4-5-9-26(25)31-29(32)35-19-27(33)23-14-12-22(13-15-23)21-6-2-1-3-7-21/h4-5,8-17,21H,1-3,6-7,18-19H2 |
| InChIKey | MMGAVYVQXQTCBQ-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.61 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |