C19H26N2O3S — CID 55311667
tert-butyl 2-[3-(3-methylbutyl)-4-oxoquinazolin-2-yl]sulfanylacetate (PubChem CID 55311667) has the molecular formula C19H26N2O3S and a molecular weight of 362.50 g/mol. Its IUPAC name is tert-butyl 2-[3-(3-methylbutyl)-4-oxoquinazolin-2-yl]sulfanylacetate.
| Compound Name | tert-butyl 2-[3-(3-methylbutyl)-4-oxoquinazolin-2-yl]sulfanylacetate |
|---|---|
| PubChem CID | 55311667 |
| Molecular Formula | C19H26N2O3S |
| Molecular Weight | 362.50 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | tert-butyl 2-[3-(3-methylbutyl)-4-oxoquinazolin-2-yl]sulfanylacetate |
| SMILES | CC(C)CCn1c(SCC(=O)OC(C)(C)C)nc2ccccc2c1=O |
| InChI | InChI=1S/C19H26N2O3S/c1-13(2)10-11-21-17(23)14-8-6-7-9-15(14)20-18(21)25-12-16(22)24-19(3,4)5/h6-9,13H,10-12H2,1-5H3 |
| InChIKey | UJYWOPCMWMWZEC-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.50 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |