C20H27N3O4S — CID 55473137
tert-butyl 2-[3-(6-amino-6-oxohexyl)-4-oxoquinazolin-2-yl]sulfanylacetate (PubChem CID 55473137) has the molecular formula C20H27N3O4S and a molecular weight of 405.52 g/mol. Its IUPAC name is tert-butyl 2-[3-(6-amino-6-oxohexyl)-4-oxoquinazolin-2-yl]sulfanylacetate.
| Compound Name | tert-butyl 2-[3-(6-amino-6-oxohexyl)-4-oxoquinazolin-2-yl]sulfanylacetate |
|---|---|
| PubChem CID | 55473137 |
| Molecular Formula | C20H27N3O4S |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | tert-butyl 2-[3-(6-amino-6-oxohexyl)-4-oxoquinazolin-2-yl]sulfanylacetate |
| SMILES | CC(C)(C)OC(=O)CSc1nc2ccccc2c(=O)n1CCCCCC(N)=O |
| InChI | InChI=1S/C20H27N3O4S/c1-20(2,3)27-17(25)13-28-19-22-15-10-7-6-9-14(15)18(26)23(19)12-8-4-5-11-16(21)24/h6-7,9-10H,4-5,8,11-13H2,1-3H3,(H2,21,24) |
| InChIKey | DSCCFRRVIBJTOD-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 104.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|