C22H23N5O5S — CID 55427442
6-[2-[2-(4-nitroanilino)-2-oxoethyl]sulfanyl-4-oxoquinazolin-3-yl]hexanamide (PubChem CID 55427442) has the molecular formula C22H23N5O5S and a molecular weight of 469.52 g/mol. Its IUPAC name is 6-[2-[2-(4-nitroanilino)-2-oxoethyl]sulfanyl-4-oxoquinazolin-3-yl]hexanamide.
| Compound Name | 6-[2-[2-(4-nitroanilino)-2-oxoethyl]sulfanyl-4-oxoquinazolin-3-yl]hexanamide |
|---|---|
| PubChem CID | 55427442 |
| Molecular Formula | C22H23N5O5S |
| Molecular Weight | 469.52 g/mol |
| Exact Mass | 469.14 |
| IUPAC Name | 6-[2-[2-(4-nitroanilino)-2-oxoethyl]sulfanyl-4-oxoquinazolin-3-yl]hexanamide |
| SMILES | NC(=O)CCCCCn1c(SCC(=O)Nc2ccc([N+](=O)[O-])cc2)nc2ccccc2c1=O |
| InChI | InChI=1S/C22H23N5O5S/c23-19(28)8-2-1-5-13-26-21(30)17-6-3-4-7-18(17)25-22(26)33-14-20(29)24-15-9-11-16(12-10-15)27(31)32/h3-4,6-7,9-12H,1-2,5,8,13-14H2,(H2,23,28)(H,24,29) |
| InChIKey | ZNFCFXDOBNMQOI-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 150.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.52 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|