C23H22FN5O3S2 — CID 55490910
6-[2-[2-[(6-fluoro-1,3-benzothiazol-2-yl)amino]-2-oxoethyl]sulfanyl-4-oxoquinazolin-3-yl]hexanamide (PubChem CID 55490910) has the molecular formula C23H22FN5O3S2 and a molecular weight of 499.59 g/mol. Its IUPAC name is 6-[2-[2-[(6-fluoro-1,3-benzothiazol-2-yl)amino]-2-oxoethyl]sulfanyl-4-oxoquinazolin-3-yl]hexanamide.
| Compound Name | 6-[2-[2-[(6-fluoro-1,3-benzothiazol-2-yl)amino]-2-oxoethyl]sulfanyl-4-oxoquinazolin-3-yl]hexanamide |
|---|---|
| PubChem CID | 55490910 |
| Molecular Formula | C23H22FN5O3S2 |
| Molecular Weight | 499.59 g/mol |
| Exact Mass | 499.11 |
| IUPAC Name | 6-[2-[2-[(6-fluoro-1,3-benzothiazol-2-yl)amino]-2-oxoethyl]sulfanyl-4-oxoquinazolin-3-yl]hexanamide |
| SMILES | NC(=O)CCCCCn1c(SCC(=O)Nc2nc3ccc(F)cc3s2)nc2ccccc2c1=O |
| InChI | InChI=1S/C23H22FN5O3S2/c24-14-9-10-17-18(12-14)34-22(26-17)28-20(31)13-33-23-27-16-7-4-3-6-15(16)21(32)29(23)11-5-1-2-8-19(25)30/h3-4,6-7,9-10,12H,1-2,5,8,11,13H2,(H2,25,30)(H,26,28,31) |
| InChIKey | CUUKVGAYPVOQKO-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 119.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.59 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|