C26H40N4O3S — CID 55427478
6-[2-[2-[bis(3-methylbutyl)amino]-2-oxoethyl]sulfanyl-4-oxoquinazolin-3-yl]hexanamide (PubChem CID 55427478) has the molecular formula C26H40N4O3S and a molecular weight of 488.70 g/mol. Its IUPAC name is 6-[2-[2-[bis(3-methylbutyl)amino]-2-oxoethyl]sulfanyl-4-oxoquinazolin-3-yl]hexanamide.
| Compound Name | 6-[2-[2-[bis(3-methylbutyl)amino]-2-oxoethyl]sulfanyl-4-oxoquinazolin-3-yl]hexanamide |
|---|---|
| PubChem CID | 55427478 |
| Molecular Formula | C26H40N4O3S |
| Molecular Weight | 488.70 g/mol |
| Exact Mass | 488.28 |
| IUPAC Name | 6-[2-[2-[bis(3-methylbutyl)amino]-2-oxoethyl]sulfanyl-4-oxoquinazolin-3-yl]hexanamide |
| SMILES | CC(C)CCN(CCC(C)C)C(=O)CSc1nc2ccccc2c(=O)n1CCCCCC(N)=O |
| InChI | InChI=1S/C26H40N4O3S/c1-19(2)13-16-29(17-14-20(3)4)24(32)18-34-26-28-22-11-8-7-10-21(22)25(33)30(26)15-9-5-6-12-23(27)31/h7-8,10-11,19-20H,5-6,9,12-18H2,1-4H3,(H2,27,31) |
| InChIKey | JGOCRXGZLRWUSE-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 98.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.70 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|