C23H26N4O4S2 — CID 55427480
6-[2-[2-[5-(acetamidomethyl)thiophen-2-yl]-2-oxoethyl]sulfanyl-4-oxoquinazolin-3-yl]hexanamide (PubChem CID 55427480) has the molecular formula C23H26N4O4S2 and a molecular weight of 486.62 g/mol. Its IUPAC name is 6-[2-[2-[5-(acetamidomethyl)thiophen-2-yl]-2-oxoethyl]sulfanyl-4-oxoquinazolin-3-yl]hexanamide.
| Compound Name | 6-[2-[2-[5-(acetamidomethyl)thiophen-2-yl]-2-oxoethyl]sulfanyl-4-oxoquinazolin-3-yl]hexanamide |
|---|---|
| PubChem CID | 55427480 |
| Molecular Formula | C23H26N4O4S2 |
| Molecular Weight | 486.62 g/mol |
| Exact Mass | 486.14 |
| IUPAC Name | 6-[2-[2-[5-(acetamidomethyl)thiophen-2-yl]-2-oxoethyl]sulfanyl-4-oxoquinazolin-3-yl]hexanamide |
| SMILES | CC(=O)NCc1ccc(C(=O)CSc2nc3ccccc3c(=O)n2CCCCCC(N)=O)s1 |
| InChI | InChI=1S/C23H26N4O4S2/c1-15(28)25-13-16-10-11-20(33-16)19(29)14-32-23-26-18-8-5-4-7-17(18)22(31)27(23)12-6-2-3-9-21(24)30/h4-5,7-8,10-11H,2-3,6,9,12-14H2,1H3,(H2,24,30)(H,25,28) |
| InChIKey | TYBFDTXNKBQKHP-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 124.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.62 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|