C20H26N4O5S2 — CID 45353177
6-[2-[2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl]sulfanyl-4-oxoquinazolin-3-yl]hexanamide (PubChem CID 45353177) has the molecular formula C20H26N4O5S2 and a molecular weight of 466.59 g/mol. Its IUPAC name is 6-[2-[2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl]sulfanyl-4-oxoquinazolin-3-yl]hexanamide.
| Compound Name | 6-[2-[2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl]sulfanyl-4-oxoquinazolin-3-yl]hexanamide |
|---|---|
| PubChem CID | 45353177 |
| Molecular Formula | C20H26N4O5S2 |
| Molecular Weight | 466.59 g/mol |
| Exact Mass | 466.13 |
| IUPAC Name | 6-[2-[2-[(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl]sulfanyl-4-oxoquinazolin-3-yl]hexanamide |
| SMILES | NC(=O)CCCCCn1c(SCC(=O)NC2CCS(=O)(=O)C2)nc2ccccc2c1=O |
| InChI | InChI=1S/C20H26N4O5S2/c21-17(25)8-2-1-5-10-24-19(27)15-6-3-4-7-16(15)23-20(24)30-12-18(26)22-14-9-11-31(28,29)13-14/h3-4,6-7,14H,1-2,5,8-13H2,(H2,21,25)(H,22,26) |
| InChIKey | GRXWFNDSNHFPJU-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 141.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.59 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|