C26H23N5O2S — CID 17418046
3-(1-phenylethyl)-2-[3-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)propylsulfanyl]quinazolin-4-one (PubChem CID 17418046) has the molecular formula C26H23N5O2S and a molecular weight of 469.57 g/mol. Its IUPAC name is 3-(1-phenylethyl)-2-[3-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)propylsulfanyl]quinazolin-4-one.
| Compound Name | 3-(1-phenylethyl)-2-[3-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)propylsulfanyl]quinazolin-4-one |
|---|---|
| PubChem CID | 17418046 |
| Molecular Formula | C26H23N5O2S |
| Molecular Weight | 469.57 g/mol |
| Exact Mass | 469.16 |
| IUPAC Name | 3-(1-phenylethyl)-2-[3-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)propylsulfanyl]quinazolin-4-one |
| SMILES | CC(c1ccccc1)n1c(SCCCc2nc(-c3cccnc3)no2)nc2ccccc2c1=O |
| InChI | InChI=1S/C26H23N5O2S/c1-18(19-9-3-2-4-10-19)31-25(32)21-12-5-6-13-22(21)28-26(31)34-16-8-14-23-29-24(30-33-23)20-11-7-15-27-17-20/h2-7,9-13,15,17-18H,8,14,16H2,1H3 |
| InChIKey | WDKFTSISIBVZAL-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 86.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.57 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|