C22H17F2N3O2S — CID 24604128
2-[[2-(difluoromethoxy)phenyl]methylsulfanyl]-3-(4-methyl-2-pyridinyl)quinazolin-4-one (PubChem CID 24604128) has the molecular formula C22H17F2N3O2S and a molecular weight of 425.46 g/mol. Its IUPAC name is 2-[[2-(difluoromethoxy)phenyl]methylsulfanyl]-3-(4-methyl-2-pyridinyl)quinazolin-4-one.
| Compound Name | 2-[[2-(difluoromethoxy)phenyl]methylsulfanyl]-3-(4-methyl-2-pyridinyl)quinazolin-4-one |
|---|---|
| PubChem CID | 24604128 |
| Molecular Formula | C22H17F2N3O2S |
| Molecular Weight | 425.46 g/mol |
| Exact Mass | 425.10 |
| IUPAC Name | 2-[[2-(difluoromethoxy)phenyl]methylsulfanyl]-3-(4-methyl-2-pyridinyl)quinazolin-4-one |
| SMILES | Cc1ccnc(-n2c(SCc3ccccc3OC(F)F)nc3ccccc3c2=O)c1 |
| InChI | InChI=1S/C22H17F2N3O2S/c1-14-10-11-25-19(12-14)27-20(28)16-7-3-4-8-17(16)26-22(27)30-13-15-6-2-5-9-18(15)29-21(23)24/h2-12,21H,13H2,1H3 |
| InChIKey | WDYKCKVUKZNSBP-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.46 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |