C9H9FO3 — CID 117279735
2-(6-fluoro-1,3-benzodioxol-5-yl)ethanol (PubChem CID 117279735) has the molecular formula C9H9FO3 and a molecular weight of 184.17 g/mol. Its IUPAC name is 2-(6-fluoro-1,3-benzodioxol-5-yl)ethanol.
| Compound Name | 2-(6-fluoro-1,3-benzodioxol-5-yl)ethanol |
|---|---|
| PubChem CID | 117279735 |
| Molecular Formula | C9H9FO3 |
| Molecular Weight | 184.17 g/mol |
| Exact Mass | 184.05 |
| IUPAC Name | 2-(6-fluoro-1,3-benzodioxol-5-yl)ethanol |
| SMILES | OCCc1cc2c(cc1F)OCO2 |
| InChI | InChI=1S/C9H9FO3/c10-7-4-9-8(12-5-13-9)3-6(7)1-2-11/h3-4,11H,1-2,5H2 |
| InChIKey | FEYFQGOUEFIWEP-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.17 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |