C10H11BrO2S — CID 10446062
5-bromo-6-(ethylsulfanylmethyl)-1,3-benzodioxole (PubChem CID 10446062) has the molecular formula C10H11BrO2S and a molecular weight of 275.17 g/mol. Its IUPAC name is 5-bromo-6-(ethylsulfanylmethyl)-1,3-benzodioxole.
| Compound Name | 5-bromo-6-(ethylsulfanylmethyl)-1,3-benzodioxole |
|---|---|
| PubChem CID | 10446062 |
| Molecular Formula | C10H11BrO2S |
| Molecular Weight | 275.17 g/mol |
| Exact Mass | 273.97 |
| IUPAC Name | 5-bromo-6-(ethylsulfanylmethyl)-1,3-benzodioxole |
| SMILES | CCSCc1cc2c(cc1Br)OCO2 |
| InChI | InChI=1S/C10H11BrO2S/c1-2-14-5-7-3-9-10(4-8(7)11)13-6-12-9/h3-4H,2,5-6H2,1H3 |
| InChIKey | OSRUNOKKJHYGFP-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.17 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |