C15H13BrO2S — CID 825356
5-bromo-6-[(4-methylphenyl)sulfanylmethyl]-1,3-benzodioxole (PubChem CID 825356) has the molecular formula C15H13BrO2S and a molecular weight of 337.24 g/mol. Its IUPAC name is 5-bromo-6-[(4-methylphenyl)sulfanylmethyl]-1,3-benzodioxole.
| Compound Name | 5-bromo-6-[(4-methylphenyl)sulfanylmethyl]-1,3-benzodioxole |
|---|---|
| PubChem CID | 825356 |
| Molecular Formula | C15H13BrO2S |
| Molecular Weight | 337.24 g/mol |
| Exact Mass | 335.98 |
| IUPAC Name | 5-bromo-6-[(4-methylphenyl)sulfanylmethyl]-1,3-benzodioxole |
| SMILES | Cc1ccc(SCc2cc3c(cc2Br)OCO3)cc1 |
| InChI | InChI=1S/C15H13BrO2S/c1-10-2-4-12(5-3-10)19-8-11-6-14-15(7-13(11)16)18-9-17-14/h2-7H,8-9H2,1H3 |
| InChIKey | QQHSQFFATHGODB-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.24 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |