C10H12ClNO4 — CID 117366479
7-(2-aminooxyethyl)-5-chloro-2,3-dihydro-1,4-benzodioxin-6-ol (PubChem CID 117366479) has the molecular formula C10H12ClNO4 and a molecular weight of 245.66 g/mol. Its IUPAC name is 7-(2-aminooxyethyl)-5-chloro-2,3-dihydro-1,4-benzodioxin-6-ol.
| Compound Name | 7-(2-aminooxyethyl)-5-chloro-2,3-dihydro-1,4-benzodioxin-6-ol |
|---|---|
| PubChem CID | 117366479 |
| Molecular Formula | C10H12ClNO4 |
| Molecular Weight | 245.66 g/mol |
| Exact Mass | 245.05 |
| IUPAC Name | 7-(2-aminooxyethyl)-5-chloro-2,3-dihydro-1,4-benzodioxin-6-ol |
| SMILES | NOCCc1cc2c(c(Cl)c1O)OCCO2 |
| InChI | InChI=1S/C10H12ClNO4/c11-8-9(13)6(1-2-16-12)5-7-10(8)15-4-3-14-7/h5,13H,1-4,12H2 |
| InChIKey | RGRQASVNEKXSNP-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 73.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.66 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|