C14H18FNO3 — CID 117421572
6-[1-(aminomethyl)cyclohexyl]-4-fluoro-1,3-benzodioxol-5-ol (PubChem CID 117421572) has the molecular formula C14H18FNO3 and a molecular weight of 267.30 g/mol. Its IUPAC name is 6-[1-(aminomethyl)cyclohexyl]-4-fluoro-1,3-benzodioxol-5-ol.
| Compound Name | 6-[1-(aminomethyl)cyclohexyl]-4-fluoro-1,3-benzodioxol-5-ol |
|---|---|
| PubChem CID | 117421572 |
| Molecular Formula | C14H18FNO3 |
| Molecular Weight | 267.30 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | 6-[1-(aminomethyl)cyclohexyl]-4-fluoro-1,3-benzodioxol-5-ol |
| SMILES | NCC1(c2cc3c(c(F)c2O)OCO3)CCCCC1 |
| InChI | InChI=1S/C14H18FNO3/c15-11-12(17)9(6-10-13(11)19-8-18-10)14(7-16)4-2-1-3-5-14/h6,17H,1-5,7-8,16H2 |
| InChIKey | GMKJYUXKSFSAPR-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.30 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |