C11H13NO3 — CID 117295658
6-[1-(aminomethyl)cyclopropyl]-1,3-benzodioxol-5-ol (PubChem CID 117295658) has the molecular formula C11H13NO3 and a molecular weight of 207.23 g/mol. Its IUPAC name is 6-[1-(aminomethyl)cyclopropyl]-1,3-benzodioxol-5-ol.
| Compound Name | 6-[1-(aminomethyl)cyclopropyl]-1,3-benzodioxol-5-ol |
|---|---|
| PubChem CID | 117295658 |
| Molecular Formula | C11H13NO3 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | 6-[1-(aminomethyl)cyclopropyl]-1,3-benzodioxol-5-ol |
| SMILES | NCC1(c2cc3c(cc2O)OCO3)CC1 |
| InChI | InChI=1S/C11H13NO3/c12-5-11(1-2-11)7-3-9-10(4-8(7)13)15-6-14-9/h3-4,13H,1-2,5-6,12H2 |
| InChIKey | BRWLJIXGMJXGQI-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |