1-(6-hydroxy-1,3-benzodioxol-5-yl)cyclohexane-1-carboxylic acid

C14H16O5 — CID 117414750

IUPAC1-(6-hydroxy-1,3-benzodioxol-5-yl)cyclohexane-1-carboxylic acid
SMILESO=C(O)C1(c2cc3c(cc2O)OCO3)CCCCC1
InChIInChI=1S/C14H16O5/c15-10-7-12-11(18-8-19-12)6-9(10)14(13(16)17)4-2-1-3-5-14/h6-7,15H,1-5,8H2,(H,16,17)
InChIKeyOVAAEOYAXBQLGU-UHFFFAOYSA-N
MW264.28 g/mol
LogP2.41
Rot. Bonds2

About 1-(6-hydroxy-1,3-benzodioxol-5-yl)cyclohexane-1-carboxylic acid

1-(6-hydroxy-1,3-benzodioxol-5-yl)cyclohexane-1-carboxylic acid (PubChem CID 117414750) has the molecular formula C14H16O5 and a molecular weight of 264.28 g/mol. Its IUPAC name is 1-(6-hydroxy-1,3-benzodioxol-5-yl)cyclohexane-1-carboxylic acid.

Molecular Properties

Compound Name1-(6-hydroxy-1,3-benzodioxol-5-yl)cyclohexane-1-carboxylic acid
PubChem CID117414750
Molecular FormulaC14H16O5
Molecular Weight264.28 g/mol
Exact Mass264.10
IUPAC Name1-(6-hydroxy-1,3-benzodioxol-5-yl)cyclohexane-1-carboxylic acid
SMILESO=C(O)C1(c2cc3c(cc2O)OCO3)CCCCC1
InChIInChI=1S/C14H16O5/c15-10-7-12-11(18-8-19-12)6-9(10)14(13(16)17)4-2-1-3-5-14/h6-7,15H,1-5,8H2,(H,16,17)
InChIKeyOVAAEOYAXBQLGU-UHFFFAOYSA-N
XLogP2.41
TPSA75.99 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500264.28
LogP ≤ 52.41
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 1-(6-hydroxy-1,3-benzodioxol-5-yl)cyclohexane-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-(6-hydroxy-1,3-benzodioxol-5-yl)cyclohexane-1-carboxylic acid?
The IUPAC name of 1-(6-hydroxy-1,3-benzodioxol-5-yl)cyclohexane-1-carboxylic acid (CID 117414750) is 1-(6-hydroxy-1,3-benzodioxol-5-yl)cyclohexane-1-carboxylic acid.
What is the SMILES notation for 1-(6-hydroxy-1,3-benzodioxol-5-yl)cyclohexane-1-carboxylic acid?
The canonical SMILES for 1-(6-hydroxy-1,3-benzodioxol-5-yl)cyclohexane-1-carboxylic acid is O=C(O)C1(c2cc3c(cc2O)OCO3)CCCCC1.
What is the InChIKey of 1-(6-hydroxy-1,3-benzodioxol-5-yl)cyclohexane-1-carboxylic acid?
The InChIKey is OVAAEOYAXBQLGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16O5/c15-10-7-12-11(18-8-19-12)6-9(10)14(13(16)17)4-2-1-3-5-14/h6-7,15H,1-5,8H2,(H,16,17).
What are the key properties of 1-(6-hydroxy-1,3-benzodioxol-5-yl)cyclohexane-1-carboxylic acid?
1-(6-hydroxy-1,3-benzodioxol-5-yl)cyclohexane-1-carboxylic acid has a molecular weight of 264.28 g/mol, XLogP of 2.41, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(6-hydroxy-1,3-benzodioxol-5-yl)cyclohexane-1-carboxylic acid is sourced from PubChem (CID 117414750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).