C14H16O6 — CID 117449718
5-(1-carboxycyclohexyl)-2,4-dihydroxybenzoic acid (PubChem CID 117449718) has the molecular formula C14H16O6 and a molecular weight of 280.28 g/mol. Its IUPAC name is 5-(1-carboxycyclohexyl)-2,4-dihydroxybenzoic acid.
| Compound Name | 5-(1-carboxycyclohexyl)-2,4-dihydroxybenzoic acid |
|---|---|
| PubChem CID | 117449718 |
| Molecular Formula | C14H16O6 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | 5-(1-carboxycyclohexyl)-2,4-dihydroxybenzoic acid |
| SMILES | O=C(O)c1cc(C2(C(=O)O)CCCCC2)c(O)cc1O |
| InChI | InChI=1S/C14H16O6/c15-10-7-11(16)9(6-8(10)12(17)18)14(13(19)20)4-2-1-3-5-14/h6-7,15-16H,1-5H2,(H,17,18)(H,19,20) |
| InChIKey | XGGXGJDTDDCMIC-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |