C10H10ClNO4 — CID 43753685
2-(7-chloro-1,3-benzodioxol-5-yl)-2-(methylamino)acetic acid (PubChem CID 43753685) has the molecular formula C10H10ClNO4 and a molecular weight of 243.65 g/mol. Its IUPAC name is 2-(7-chloro-1,3-benzodioxol-5-yl)-2-(methylamino)acetic acid.
| Compound Name | 2-(7-chloro-1,3-benzodioxol-5-yl)-2-(methylamino)acetic acid |
|---|---|
| PubChem CID | 43753685 |
| Molecular Formula | C10H10ClNO4 |
| Molecular Weight | 243.65 g/mol |
| Exact Mass | 243.03 |
| IUPAC Name | 2-(7-chloro-1,3-benzodioxol-5-yl)-2-(methylamino)acetic acid |
| SMILES | CNC(C(=O)O)c1cc(Cl)c2c(c1)OCO2 |
| InChI | InChI=1S/C10H10ClNO4/c1-12-8(10(13)14)5-2-6(11)9-7(3-5)15-4-16-9/h2-3,8,12H,4H2,1H3,(H,13,14) |
| InChIKey | RWTZXCSLDOYURT-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.65 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |