C12H12ClNO5 — CID 63688696
2-(7-chloro-1,3-benzodioxol-5-yl)-2-[ethyl(formyl)amino]acetic acid (PubChem CID 63688696) has the molecular formula C12H12ClNO5 and a molecular weight of 285.68 g/mol. Its IUPAC name is 2-(7-chloro-1,3-benzodioxol-5-yl)-2-[ethyl(formyl)amino]acetic acid.
| Compound Name | 2-(7-chloro-1,3-benzodioxol-5-yl)-2-[ethyl(formyl)amino]acetic acid |
|---|---|
| PubChem CID | 63688696 |
| Molecular Formula | C12H12ClNO5 |
| Molecular Weight | 285.68 g/mol |
| Exact Mass | 285.04 |
| IUPAC Name | 2-(7-chloro-1,3-benzodioxol-5-yl)-2-[ethyl(formyl)amino]acetic acid |
| SMILES | CCN(C=O)C(C(=O)O)c1cc(Cl)c2c(c1)OCO2 |
| InChI | InChI=1S/C12H12ClNO5/c1-2-14(5-15)10(12(16)17)7-3-8(13)11-9(4-7)18-6-19-11/h3-5,10H,2,6H2,1H3,(H,16,17) |
| InChIKey | OSALSWJDYNJQLO-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.68 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|