C14H16ClNO4 — CID 64528915
3-(7-chloro-1,3-benzodioxol-5-yl)-3-pyrrolidin-1-ylpropanoic acid (PubChem CID 64528915) has the molecular formula C14H16ClNO4 and a molecular weight of 297.74 g/mol. Its IUPAC name is 3-(7-chloro-1,3-benzodioxol-5-yl)-3-pyrrolidin-1-ylpropanoic acid.
| Compound Name | 3-(7-chloro-1,3-benzodioxol-5-yl)-3-pyrrolidin-1-ylpropanoic acid |
|---|---|
| PubChem CID | 64528915 |
| Molecular Formula | C14H16ClNO4 |
| Molecular Weight | 297.74 g/mol |
| Exact Mass | 297.08 |
| IUPAC Name | 3-(7-chloro-1,3-benzodioxol-5-yl)-3-pyrrolidin-1-ylpropanoic acid |
| SMILES | O=C(O)CC(c1cc(Cl)c2c(c1)OCO2)N1CCCC1 |
| InChI | InChI=1S/C14H16ClNO4/c15-10-5-9(6-12-14(10)20-8-19-12)11(7-13(17)18)16-3-1-2-4-16/h5-6,11H,1-4,7-8H2,(H,17,18) |
| InChIKey | XYGVHYHIKZJEFN-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.74 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |