C16H23ClN2O2 — CID 63622574
2-(7-chloro-1,3-benzodioxol-5-yl)-2-(4-methylazepan-1-yl)ethanamine (PubChem CID 63622574) has the molecular formula C16H23ClN2O2 and a molecular weight of 310.83 g/mol. Its IUPAC name is 2-(7-chloro-1,3-benzodioxol-5-yl)-2-(4-methylazepan-1-yl)ethanamine.
| Compound Name | 2-(7-chloro-1,3-benzodioxol-5-yl)-2-(4-methylazepan-1-yl)ethanamine |
|---|---|
| PubChem CID | 63622574 |
| Molecular Formula | C16H23ClN2O2 |
| Molecular Weight | 310.83 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | 2-(7-chloro-1,3-benzodioxol-5-yl)-2-(4-methylazepan-1-yl)ethanamine |
| SMILES | CC1CCCN(C(CN)c2cc(Cl)c3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C16H23ClN2O2/c1-11-3-2-5-19(6-4-11)14(9-18)12-7-13(17)16-15(8-12)20-10-21-16/h7-8,11,14H,2-6,9-10,18H2,1H3 |
| InChIKey | PXIHHVZJCJUHRQ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.83 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |