C16H23ClN2O2 — CID 65381952
1-(7-chloro-1,3-benzodioxol-5-yl)-N-cycloheptylethane-1,2-diamine (PubChem CID 65381952) has the molecular formula C16H23ClN2O2 and a molecular weight of 310.83 g/mol. Its IUPAC name is 1-(7-chloro-1,3-benzodioxol-5-yl)-N-cycloheptylethane-1,2-diamine.
| Compound Name | 1-(7-chloro-1,3-benzodioxol-5-yl)-N-cycloheptylethane-1,2-diamine |
|---|---|
| PubChem CID | 65381952 |
| Molecular Formula | C16H23ClN2O2 |
| Molecular Weight | 310.83 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | 1-(7-chloro-1,3-benzodioxol-5-yl)-N-cycloheptylethane-1,2-diamine |
| SMILES | NCC(NC1CCCCCC1)c1cc(Cl)c2c(c1)OCO2 |
| InChI | InChI=1S/C16H23ClN2O2/c17-13-7-11(8-15-16(13)21-10-20-15)14(9-18)19-12-5-3-1-2-4-6-12/h7-8,12,14,19H,1-6,9-10,18H2 |
| InChIKey | SLYHKMDSGOYWIT-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.83 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |