C14H20F2N2 — CID 106528693
N-cyclohexyl-1-(3,5-difluorophenyl)ethane-1,2-diamine (PubChem CID 106528693) has the molecular formula C14H20F2N2 and a molecular weight of 254.32 g/mol. Its IUPAC name is N-cyclohexyl-1-(3,5-difluorophenyl)ethane-1,2-diamine.
| Compound Name | N-cyclohexyl-1-(3,5-difluorophenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 106528693 |
| Molecular Formula | C14H20F2N2 |
| Molecular Weight | 254.32 g/mol |
| Exact Mass | 254.16 |
| IUPAC Name | N-cyclohexyl-1-(3,5-difluorophenyl)ethane-1,2-diamine |
| SMILES | NCC(NC1CCCCC1)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C14H20F2N2/c15-11-6-10(7-12(16)8-11)14(9-17)18-13-4-2-1-3-5-13/h6-8,13-14,18H,1-5,9,17H2 |
| InChIKey | VHICUGPEAUMODO-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.32 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |