C11H14F2N2 — CID 106528632
N-cyclopropyl-1-(3,5-difluorophenyl)ethane-1,2-diamine (PubChem CID 106528632) has the molecular formula C11H14F2N2 and a molecular weight of 212.24 g/mol. Its IUPAC name is N-cyclopropyl-1-(3,5-difluorophenyl)ethane-1,2-diamine.
| Compound Name | N-cyclopropyl-1-(3,5-difluorophenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 106528632 |
| Molecular Formula | C11H14F2N2 |
| Molecular Weight | 212.24 g/mol |
| Exact Mass | 212.11 |
| IUPAC Name | N-cyclopropyl-1-(3,5-difluorophenyl)ethane-1,2-diamine |
| SMILES | NCC(NC1CC1)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C11H14F2N2/c12-8-3-7(4-9(13)5-8)11(6-14)15-10-1-2-10/h3-5,10-11,15H,1-2,6,14H2 |
| InChIKey | ABCNNSZXAOTARI-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.24 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |