C14H19NO2S — CID 117417930
2-[(4-methylsulfanyl-1,3-benzodioxol-5-yl)methyl]piperidine (PubChem CID 117417930) has the molecular formula C14H19NO2S and a molecular weight of 265.38 g/mol. Its IUPAC name is 2-[(4-methylsulfanyl-1,3-benzodioxol-5-yl)methyl]piperidine.
| Compound Name | 2-[(4-methylsulfanyl-1,3-benzodioxol-5-yl)methyl]piperidine |
|---|---|
| PubChem CID | 117417930 |
| Molecular Formula | C14H19NO2S |
| Molecular Weight | 265.38 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | 2-[(4-methylsulfanyl-1,3-benzodioxol-5-yl)methyl]piperidine |
| SMILES | CSc1c(CC2CCCCN2)ccc2c1OCO2 |
| InChI | InChI=1S/C14H19NO2S/c1-18-14-10(8-11-4-2-3-7-15-11)5-6-12-13(14)17-9-16-12/h5-6,11,15H,2-4,7-9H2,1H3 |
| InChIKey | NRMHFWVTOLWTLG-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.38 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |