C9H7NO2S — CID 117283483
4-methylsulfanyl-1,3-benzodioxole-5-carbonitrile (PubChem CID 117283483) has the molecular formula C9H7NO2S and a molecular weight of 193.23 g/mol. Its IUPAC name is 4-methylsulfanyl-1,3-benzodioxole-5-carbonitrile.
| Compound Name | 4-methylsulfanyl-1,3-benzodioxole-5-carbonitrile |
|---|---|
| PubChem CID | 117283483 |
| Molecular Formula | C9H7NO2S |
| Molecular Weight | 193.23 g/mol |
| Exact Mass | 193.02 |
| IUPAC Name | 4-methylsulfanyl-1,3-benzodioxole-5-carbonitrile |
| SMILES | CSc1c(C#N)ccc2c1OCO2 |
| InChI | InChI=1S/C9H7NO2S/c1-13-9-6(4-10)2-3-7-8(9)12-5-11-7/h2-3H,5H2,1H3 |
| InChIKey | LLXPYJVGJLOANW-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.23 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |