C12H9NO2 — CID 10655602
8,9-dihydrobenzo[g][1,3]benzodioxole-6-carbonitrile (PubChem CID 10655602) has the molecular formula C12H9NO2 and a molecular weight of 199.21 g/mol. Its IUPAC name is 8,9-dihydrobenzo[g][1,3]benzodioxole-6-carbonitrile.
| Compound Name | 8,9-dihydrobenzo[g][1,3]benzodioxole-6-carbonitrile |
|---|---|
| PubChem CID | 10655602 |
| Molecular Formula | C12H9NO2 |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.06 |
| IUPAC Name | 8,9-dihydrobenzo[g][1,3]benzodioxole-6-carbonitrile |
| SMILES | N#CC1=CCCc2c1ccc1c2OCO1 |
| InChI | InChI=1S/C12H9NO2/c13-6-8-2-1-3-10-9(8)4-5-11-12(10)15-7-14-11/h2,4-5H,1,3,7H2 |
| InChIKey | VSLDXLMCJNRCDL-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |