C12H11BrO4 — CID 117481527
5-bromo-7-(4-oxobutan-2-yl)-1,3-benzodioxole-4-carbaldehyde (PubChem CID 117481527) has the molecular formula C12H11BrO4 and a molecular weight of 299.12 g/mol. Its IUPAC name is 5-bromo-7-(4-oxobutan-2-yl)-1,3-benzodioxole-4-carbaldehyde.
| Compound Name | 5-bromo-7-(4-oxobutan-2-yl)-1,3-benzodioxole-4-carbaldehyde |
|---|---|
| PubChem CID | 117481527 |
| Molecular Formula | C12H11BrO4 |
| Molecular Weight | 299.12 g/mol |
| Exact Mass | 297.98 |
| IUPAC Name | 5-bromo-7-(4-oxobutan-2-yl)-1,3-benzodioxole-4-carbaldehyde |
| SMILES | CC(CC=O)c1cc(Br)c(C=O)c2c1OCO2 |
| InChI | InChI=1S/C12H11BrO4/c1-7(2-3-14)8-4-10(13)9(5-15)12-11(8)16-6-17-12/h3-5,7H,2,6H2,1H3 |
| InChIKey | AGWQVIUBXLXXID-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.12 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|