C10H7BrO6 — CID 117487656
2-(6-bromo-7-formyl-1,3-benzodioxol-4-yl)-2-hydroxyacetic acid (PubChem CID 117487656) has the molecular formula C10H7BrO6 and a molecular weight of 303.06 g/mol. Its IUPAC name is 2-(6-bromo-7-formyl-1,3-benzodioxol-4-yl)-2-hydroxyacetic acid.
| Compound Name | 2-(6-bromo-7-formyl-1,3-benzodioxol-4-yl)-2-hydroxyacetic acid |
|---|---|
| PubChem CID | 117487656 |
| Molecular Formula | C10H7BrO6 |
| Molecular Weight | 303.06 g/mol |
| Exact Mass | 301.94 |
| IUPAC Name | 2-(6-bromo-7-formyl-1,3-benzodioxol-4-yl)-2-hydroxyacetic acid |
| SMILES | O=Cc1c(Br)cc(C(O)C(=O)O)c2c1OCO2 |
| InChI | InChI=1S/C10H7BrO6/c11-6-1-4(7(13)10(14)15)8-9(5(6)2-12)17-3-16-8/h1-2,7,13H,3H2,(H,14,15) |
| InChIKey | VXUWTIAJEYTGFR-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.06 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|