C12H13BrO4 — CID 117484829
3-(5-bromo-6-hydroxy-2,3-dihydro-1,4-benzodioxin-7-yl)butanal (PubChem CID 117484829) has the molecular formula C12H13BrO4 and a molecular weight of 301.14 g/mol. Its IUPAC name is 3-(5-bromo-6-hydroxy-2,3-dihydro-1,4-benzodioxin-7-yl)butanal.
| Compound Name | 3-(5-bromo-6-hydroxy-2,3-dihydro-1,4-benzodioxin-7-yl)butanal |
|---|---|
| PubChem CID | 117484829 |
| Molecular Formula | C12H13BrO4 |
| Molecular Weight | 301.14 g/mol |
| Exact Mass | 300.00 |
| IUPAC Name | 3-(5-bromo-6-hydroxy-2,3-dihydro-1,4-benzodioxin-7-yl)butanal |
| SMILES | CC(CC=O)c1cc2c(c(Br)c1O)OCCO2 |
| InChI | InChI=1S/C12H13BrO4/c1-7(2-3-14)8-6-9-12(10(13)11(8)15)17-5-4-16-9/h3,6-7,15H,2,4-5H2,1H3 |
| InChIKey | KLLMGQGJTPQHNY-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.14 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|