C10H13ClFNO3 — CID 84707099
2-amino-1-(5-chloro-3-fluoro-2,4-dimethoxyphenyl)ethanol (PubChem CID 84707099) has the molecular formula C10H13ClFNO3 and a molecular weight of 249.67 g/mol. Its IUPAC name is 2-amino-1-(5-chloro-3-fluoro-2,4-dimethoxyphenyl)ethanol.
| Compound Name | 2-amino-1-(5-chloro-3-fluoro-2,4-dimethoxyphenyl)ethanol |
|---|---|
| PubChem CID | 84707099 |
| Molecular Formula | C10H13ClFNO3 |
| Molecular Weight | 249.67 g/mol |
| Exact Mass | 249.06 |
| IUPAC Name | 2-amino-1-(5-chloro-3-fluoro-2,4-dimethoxyphenyl)ethanol |
| SMILES | COc1c(Cl)cc(C(O)CN)c(OC)c1F |
| InChI | InChI=1S/C10H13ClFNO3/c1-15-9-5(7(14)4-13)3-6(11)10(16-2)8(9)12/h3,7,14H,4,13H2,1-2H3 |
| InChIKey | UACYWFCMZLYXGH-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.67 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |