C9H9ClFNO4 — CID 117377798
2-amino-2-(3-chloro-2-fluoro-5-hydroxy-6-methoxyphenyl)acetic acid (PubChem CID 117377798) has the molecular formula C9H9ClFNO4 and a molecular weight of 249.62 g/mol. Its IUPAC name is 2-amino-2-(3-chloro-2-fluoro-5-hydroxy-6-methoxyphenyl)acetic acid.
| Compound Name | 2-amino-2-(3-chloro-2-fluoro-5-hydroxy-6-methoxyphenyl)acetic acid |
|---|---|
| PubChem CID | 117377798 |
| Molecular Formula | C9H9ClFNO4 |
| Molecular Weight | 249.62 g/mol |
| Exact Mass | 249.02 |
| IUPAC Name | 2-amino-2-(3-chloro-2-fluoro-5-hydroxy-6-methoxyphenyl)acetic acid |
| SMILES | COc1c(O)cc(Cl)c(F)c1C(N)C(=O)O |
| InChI | InChI=1S/C9H9ClFNO4/c1-16-8-4(13)2-3(10)6(11)5(8)7(12)9(14)15/h2,7,13H,12H2,1H3,(H,14,15) |
| InChIKey | SEUNNHIHUCYXHY-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.62 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |