C9H8ClFO5 — CID 117379954
2-(5-chloro-4-fluoro-2-hydroxy-3-methoxyphenyl)-2-hydroxyacetic acid (PubChem CID 117379954) has the molecular formula C9H8ClFO5 and a molecular weight of 250.61 g/mol. Its IUPAC name is 2-(5-chloro-4-fluoro-2-hydroxy-3-methoxyphenyl)-2-hydroxyacetic acid.
| Compound Name | 2-(5-chloro-4-fluoro-2-hydroxy-3-methoxyphenyl)-2-hydroxyacetic acid |
|---|---|
| PubChem CID | 117379954 |
| Molecular Formula | C9H8ClFO5 |
| Molecular Weight | 250.61 g/mol |
| Exact Mass | 250.00 |
| IUPAC Name | 2-(5-chloro-4-fluoro-2-hydroxy-3-methoxyphenyl)-2-hydroxyacetic acid |
| SMILES | COc1c(O)c(C(O)C(=O)O)cc(Cl)c1F |
| InChI | InChI=1S/C9H8ClFO5/c1-16-8-5(11)4(10)2-3(6(8)12)7(13)9(14)15/h2,7,12-13H,1H3,(H,14,15) |
| InChIKey | ITPBJKOQHSQSIZ-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.61 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |