C7H6ClFO3 — CID 84664376
5-chloro-4-fluoro-3-methoxybenzene-1,2-diol (PubChem CID 84664376) has the molecular formula C7H6ClFO3 and a molecular weight of 192.57 g/mol. Its IUPAC name is 5-chloro-4-fluoro-3-methoxybenzene-1,2-diol.
| Compound Name | 5-chloro-4-fluoro-3-methoxybenzene-1,2-diol |
|---|---|
| PubChem CID | 84664376 |
| Molecular Formula | C7H6ClFO3 |
| Molecular Weight | 192.57 g/mol |
| Exact Mass | 192.00 |
| IUPAC Name | 5-chloro-4-fluoro-3-methoxybenzene-1,2-diol |
| SMILES | COc1c(O)c(O)cc(Cl)c1F |
| InChI | InChI=1S/C7H6ClFO3/c1-12-7-5(9)3(8)2-4(10)6(7)11/h2,10-11H,1H3 |
| InChIKey | SBWNKHOPUXIMMO-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.57 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|