C11H10F2O5 — CID 117404185
2-[3-(difluoromethyl)-4,5-dimethoxyphenyl]-2-oxoacetic acid (PubChem CID 117404185) has the molecular formula C11H10F2O5 and a molecular weight of 260.19 g/mol. Its IUPAC name is 2-[3-(difluoromethyl)-4,5-dimethoxyphenyl]-2-oxoacetic acid.
| Compound Name | 2-[3-(difluoromethyl)-4,5-dimethoxyphenyl]-2-oxoacetic acid |
|---|---|
| PubChem CID | 117404185 |
| Molecular Formula | C11H10F2O5 |
| Molecular Weight | 260.19 g/mol |
| Exact Mass | 260.05 |
| IUPAC Name | 2-[3-(difluoromethyl)-4,5-dimethoxyphenyl]-2-oxoacetic acid |
| SMILES | COc1cc(C(=O)C(=O)O)cc(C(F)F)c1OC |
| InChI | InChI=1S/C11H10F2O5/c1-17-7-4-5(8(14)11(15)16)3-6(10(12)13)9(7)18-2/h3-4,10H,1-2H3,(H,15,16) |
| InChIKey | DOJLVLPEYXLVCO-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.19 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|