C13H15FO5 — CID 141408275
2-fluoro-1-(3,4,5-trimethoxyphenyl)butane-1,3-dione (PubChem CID 141408275) has the molecular formula C13H15FO5 and a molecular weight of 270.26 g/mol. Its IUPAC name is 2-fluoro-1-(3,4,5-trimethoxyphenyl)butane-1,3-dione.
| Compound Name | 2-fluoro-1-(3,4,5-trimethoxyphenyl)butane-1,3-dione |
|---|---|
| PubChem CID | 141408275 |
| Molecular Formula | C13H15FO5 |
| Molecular Weight | 270.26 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | 2-fluoro-1-(3,4,5-trimethoxyphenyl)butane-1,3-dione |
| SMILES | COc1cc(C(=O)C(F)C(C)=O)cc(OC)c1OC |
| InChI | InChI=1S/C13H15FO5/c1-7(15)11(14)12(16)8-5-9(17-2)13(19-4)10(6-8)18-3/h5-6,11H,1-4H3 |
| InChIKey | VHJXAOLMVHZHOA-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.26 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|