C24H29NO7 — CID 139882558
methyl 2-[[1,3-dioxo-1-phenyl-3-(3,4,5-trimethoxyphenyl)propan-2-yl]amino]-3-methylbutanoate (PubChem CID 139882558) has the molecular formula C24H29NO7 and a molecular weight of 443.50 g/mol. Its IUPAC name is methyl 2-[[1,3-dioxo-1-phenyl-3-(3,4,5-trimethoxyphenyl)propan-2-yl]amino]-3-methylbutanoate.
| Compound Name | methyl 2-[[1,3-dioxo-1-phenyl-3-(3,4,5-trimethoxyphenyl)propan-2-yl]amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 139882558 |
| Molecular Formula | C24H29NO7 |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.19 |
| IUPAC Name | methyl 2-[[1,3-dioxo-1-phenyl-3-(3,4,5-trimethoxyphenyl)propan-2-yl]amino]-3-methylbutanoate |
| SMILES | COC(=O)C(NC(C(=O)c1ccccc1)C(=O)c1cc(OC)c(OC)c(OC)c1)C(C)C |
| InChI | InChI=1S/C24H29NO7/c1-14(2)19(24(28)32-6)25-20(21(26)15-10-8-7-9-11-15)22(27)16-12-17(29-3)23(31-5)18(13-16)30-4/h7-14,19-20,25H,1-6H3 |
| InChIKey | XJRKSZBIAKTXCN-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|