C16H21F2NO2 — CID 106528954
methyl 2-(cycloheptylamino)-2-(3,5-difluorophenyl)acetate (PubChem CID 106528954) has the molecular formula C16H21F2NO2 and a molecular weight of 297.35 g/mol. Its IUPAC name is methyl 2-(cycloheptylamino)-2-(3,5-difluorophenyl)acetate.
| Compound Name | methyl 2-(cycloheptylamino)-2-(3,5-difluorophenyl)acetate |
|---|---|
| PubChem CID | 106528954 |
| Molecular Formula | C16H21F2NO2 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | methyl 2-(cycloheptylamino)-2-(3,5-difluorophenyl)acetate |
| SMILES | COC(=O)C(NC1CCCCCC1)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C16H21F2NO2/c1-21-16(20)15(11-8-12(17)10-13(18)9-11)19-14-6-4-2-3-5-7-14/h8-10,14-15,19H,2-7H2,1H3 |
| InChIKey | ISFNCHHFFDCFBI-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |